C4H8Cl2S — CID 119095673
1,1-dichloro-3-methylsulfanylpropane (PubChem CID 119095673) has the molecular formula C4H8Cl2S and a molecular weight of 159.08 g/mol. Its IUPAC name is 1,1-dichloro-3-methylsulfanylpropane.
| Compound Name | 1,1-dichloro-3-methylsulfanylpropane |
|---|---|
| PubChem CID | 119095673 |
| Molecular Formula | C4H8Cl2S |
| Molecular Weight | 159.08 g/mol |
| Exact Mass | 157.97 |
| IUPAC Name | 1,1-dichloro-3-methylsulfanylpropane |
| SMILES | CSCCC(Cl)Cl |
| InChI | InChI=1S/C4H8Cl2S/c1-7-3-2-4(5)6/h4H,2-3H2,1H3 |
| InChIKey | QFMGQMVJMVIKSH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.08 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|