About 3-methylsulfanylpropane-1,1-diol;hydrate
3-methylsulfanylpropane-1,1-diol;hydrate (PubChem CID 162477816) has the molecular formula C4H12O3S
and a molecular weight of 140.20 g/mol. Its IUPAC name is 3-methylsulfanylpropane-1,1-diol;hydrate.
Molecular Properties
| Compound Name | 3-methylsulfanylpropane-1,1-diol;hydrate |
| PubChem CID | 162477816 |
| Molecular Formula | C4H12O3S |
| Molecular Weight | 140.20 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 3-methylsulfanylpropane-1,1-diol;hydrate |
| SMILES | CSCCC(O)O.O |
| InChI | InChI=1S/C4H10O2S.H2O/c1-7-3-2-4(5)6;/h4-6H,2-3H2,1H3;1H2 |
| InChIKey | BXXYQGRVCYLMSJ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfanylpropane-1,1-diol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanylpropane-1,1-diol;hydrate?
The IUPAC name of 3-methylsulfanylpropane-1,1-diol;hydrate (CID 162477816) is 3-methylsulfanylpropane-1,1-diol;hydrate.
What is the SMILES notation for 3-methylsulfanylpropane-1,1-diol;hydrate?
The canonical SMILES for 3-methylsulfanylpropane-1,1-diol;hydrate is CSCCC(O)O.O.
What is the InChIKey of 3-methylsulfanylpropane-1,1-diol;hydrate?
The InChIKey is BXXYQGRVCYLMSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2S.H2O/c1-7-3-2-4(5)6;/h4-6H,2-3H2,1H3;1H2.
What are the key properties of 3-methylsulfanylpropane-1,1-diol;hydrate?
3-methylsulfanylpropane-1,1-diol;hydrate has a molecular weight of 140.20 g/mol, XLogP of -0.77, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanylpropane-1,1-diol;hydrate is sourced from PubChem (CID 162477816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).