C4H12O3S — CID 162477816
3-methylsulfanylpropane-1,1-diol;hydrate (PubChem CID 162477816) has the molecular formula C4H12O3S and a molecular weight of 140.20 g/mol. Its IUPAC name is 3-methylsulfanylpropane-1,1-diol;hydrate.
| Compound Name | 3-methylsulfanylpropane-1,1-diol;hydrate |
|---|---|
| PubChem CID | 162477816 |
| Molecular Formula | C4H12O3S |
| Molecular Weight | 140.20 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 3-methylsulfanylpropane-1,1-diol;hydrate |
| SMILES | CSCCC(O)O.O |
| InChI | InChI=1S/C4H10O2S.H2O/c1-7-3-2-4(5)6;/h4-6H,2-3H2,1H3;1H2 |
| InChIKey | BXXYQGRVCYLMSJ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|