C5H10Cl2S — CID 174532018
1,2-dichloro-4-methylsulfanylbutane (PubChem CID 174532018) has the molecular formula C5H10Cl2S and a molecular weight of 173.11 g/mol. Its IUPAC name is 1,2-dichloro-4-methylsulfanylbutane.
| Compound Name | 1,2-dichloro-4-methylsulfanylbutane |
|---|---|
| PubChem CID | 174532018 |
| Molecular Formula | C5H10Cl2S |
| Molecular Weight | 173.11 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 1,2-dichloro-4-methylsulfanylbutane |
| SMILES | CSCCC(Cl)CCl |
| InChI | InChI=1S/C5H10Cl2S/c1-8-3-2-5(7)4-6/h5H,2-4H2,1H3 |
| InChIKey | LJNQNEPIZLDRDL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|