C3H6Cl2O2 — CID 87509351
3,3-dichloropropane-1,1-diol (PubChem CID 87509351) has the molecular formula C3H6Cl2O2 and a molecular weight of 144.99 g/mol. Its IUPAC name is 3,3-dichloropropane-1,1-diol.
| Compound Name | 3,3-dichloropropane-1,1-diol |
|---|---|
| PubChem CID | 87509351 |
| Molecular Formula | C3H6Cl2O2 |
| Molecular Weight | 144.99 g/mol |
| Exact Mass | 143.97 |
| IUPAC Name | 3,3-dichloropropane-1,1-diol |
| SMILES | OC(O)CC(Cl)Cl |
| InChI | InChI=1S/C3H6Cl2O2/c4-2(5)1-3(6)7/h2-3,6-7H,1H2 |
| InChIKey | QMNVKLMFSFPUIK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.99 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|