About azane;2,2-dichloroethanol
azane;2,2-dichloroethanol (PubChem CID 87173184) has the molecular formula C2H7Cl2NO
and a molecular weight of 131.99 g/mol. Its IUPAC name is azane;2,2-dichloroethanol.
Molecular Properties
| Compound Name | azane;2,2-dichloroethanol |
| PubChem CID | 87173184 |
| Molecular Formula | C2H7Cl2NO |
| Molecular Weight | 131.99 g/mol |
| Exact Mass | 130.99 |
| IUPAC Name | azane;2,2-dichloroethanol |
| SMILES | N.OCC(Cl)Cl |
| InChI | InChI=1S/C2H4Cl2O.H3N/c3-2(4)1-5;/h2,5H,1H2;1H3 |
| InChIKey | FRILRURBUFJBCN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.99 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;2,2-dichloroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,2-dichloroethanol?
The IUPAC name of azane;2,2-dichloroethanol (CID 87173184) is azane;2,2-dichloroethanol.
What is the SMILES notation for azane;2,2-dichloroethanol?
The canonical SMILES for azane;2,2-dichloroethanol is N.OCC(Cl)Cl.
What is the InChIKey of azane;2,2-dichloroethanol?
The InChIKey is FRILRURBUFJBCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Cl2O.H3N/c3-2(4)1-5;/h2,5H,1H2;1H3.
What are the key properties of azane;2,2-dichloroethanol?
azane;2,2-dichloroethanol has a molecular weight of 131.99 g/mol, XLogP of 0.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,2-dichloroethanol is sourced from PubChem (CID 87173184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).