About 2,3-dichloropropan-1-ol;hydrate
2,3-dichloropropan-1-ol;hydrate (PubChem CID 88835584) has the molecular formula C3H8Cl2O2
and a molecular weight of 147.00 g/mol. Its IUPAC name is 2,3-dichloropropan-1-ol;hydrate.
Molecular Properties
| Compound Name | 2,3-dichloropropan-1-ol;hydrate |
| PubChem CID | 88835584 |
| Molecular Formula | C3H8Cl2O2 |
| Molecular Weight | 147.00 g/mol |
| Exact Mass | 145.99 |
| IUPAC Name | 2,3-dichloropropan-1-ol;hydrate |
| SMILES | O.OCC(Cl)CCl |
| InChI | InChI=1S/C3H6Cl2O.H2O/c4-1-3(5)2-6;/h3,6H,1-2H2;1H2 |
| InChIKey | KIXXFINLTLLILG-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.00 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dichloropropan-1-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloropropan-1-ol;hydrate?
The IUPAC name of 2,3-dichloropropan-1-ol;hydrate (CID 88835584) is 2,3-dichloropropan-1-ol;hydrate.
What is the SMILES notation for 2,3-dichloropropan-1-ol;hydrate?
The canonical SMILES for 2,3-dichloropropan-1-ol;hydrate is O.OCC(Cl)CCl.
What is the InChIKey of 2,3-dichloropropan-1-ol;hydrate?
The InChIKey is KIXXFINLTLLILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6Cl2O.H2O/c4-1-3(5)2-6;/h3,6H,1-2H2;1H2.
What are the key properties of 2,3-dichloropropan-1-ol;hydrate?
2,3-dichloropropan-1-ol;hydrate has a molecular weight of 147.00 g/mol, XLogP of 0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloropropan-1-ol;hydrate is sourced from PubChem (CID 88835584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).