C6H14Cl2O4 — CID 161482060
1-chloropropane-1,1-diol;2-chloropropane-1,3-diol (PubChem CID 161482060) has the molecular formula C6H14Cl2O4 and a molecular weight of 221.08 g/mol. Its IUPAC name is 1-chloropropane-1,1-diol;2-chloropropane-1,3-diol.
| Compound Name | 1-chloropropane-1,1-diol;2-chloropropane-1,3-diol |
|---|---|
| PubChem CID | 161482060 |
| Molecular Formula | C6H14Cl2O4 |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 1-chloropropane-1,1-diol;2-chloropropane-1,3-diol |
| SMILES | CCC(O)(O)Cl.OCC(Cl)CO |
| InChI | InChI=1S/2C3H7ClO2/c4-3(1-5)2-6;1-2-3(4,5)6/h3,5-6H,1-2H2;5-6H,2H2,1H3 |
| InChIKey | WEMLVYIABOMXNO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|