C5H7Cl7 — CID 18956861
1,1,2,2-tetrachloroethane;1,1,1-trichloropropane (PubChem CID 18956861) has the molecular formula C5H7Cl7 and a molecular weight of 315.28 g/mol. Its IUPAC name is 1,1,2,2-tetrachloroethane;1,1,1-trichloropropane.
| Compound Name | 1,1,2,2-tetrachloroethane;1,1,1-trichloropropane |
|---|---|
| PubChem CID | 18956861 |
| Molecular Formula | C5H7Cl7 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 311.84 |
| IUPAC Name | 1,1,2,2-tetrachloroethane;1,1,1-trichloropropane |
| SMILES | CCC(Cl)(Cl)Cl.ClC(Cl)C(Cl)Cl |
| InChI | InChI=1S/C3H5Cl3.C2H2Cl4/c1-2-3(4,5)6;3-1(4)2(5)6/h2H2,1H3;1-2H |
| InChIKey | MDDCFFBWXGYCEI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|