C5H6Cl6 — CID 19861673
1,1,2-trichloroethene;1,1,1-trichloropropane (PubChem CID 19861673) has the molecular formula C5H6Cl6 and a molecular weight of 278.82 g/mol. Its IUPAC name is 1,1,2-trichloroethene;1,1,1-trichloropropane.
| Compound Name | 1,1,2-trichloroethene;1,1,1-trichloropropane |
|---|---|
| PubChem CID | 19861673 |
| Molecular Formula | C5H6Cl6 |
| Molecular Weight | 278.82 g/mol |
| Exact Mass | 275.86 |
| IUPAC Name | 1,1,2-trichloroethene;1,1,1-trichloropropane |
| SMILES | CCC(Cl)(Cl)Cl.ClC=C(Cl)Cl |
| InChI | InChI=1S/C3H5Cl3.C2HCl3/c1-2-3(4,5)6;3-1-2(4)5/h2H2,1H3;1H |
| InChIKey | PNTFJQIOLRGCQX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.82 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|