About 2,3-dichloropropan-1-ol;hydron
2,3-dichloropropan-1-ol;hydron (PubChem CID 174396616) has the molecular formula C3H7Cl2O+
and a molecular weight of 129.99 g/mol. Its IUPAC name is 2,3-dichloropropan-1-ol;hydron.
Molecular Properties
| Compound Name | 2,3-dichloropropan-1-ol;hydron |
| PubChem CID | 174396616 |
| Molecular Formula | C3H7Cl2O+ |
| Molecular Weight | 129.99 g/mol |
| Exact Mass | 128.99 |
| IUPAC Name | 2,3-dichloropropan-1-ol;hydron |
| SMILES | OCC(Cl)CCl.[H+] |
| InChI | InChI=1S/C3H6Cl2O/c4-1-3(5)2-6/h3,6H,1-2H2/p+1 |
| InChIKey | ZXCYIJGIGSDJQQ-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.99 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dichloropropan-1-ol;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloropropan-1-ol;hydron?
The IUPAC name of 2,3-dichloropropan-1-ol;hydron (CID 174396616) is 2,3-dichloropropan-1-ol;hydron.
What is the SMILES notation for 2,3-dichloropropan-1-ol;hydron?
The canonical SMILES for 2,3-dichloropropan-1-ol;hydron is OCC(Cl)CCl.[H+].
What is the InChIKey of 2,3-dichloropropan-1-ol;hydron?
The InChIKey is ZXCYIJGIGSDJQQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H6Cl2O/c4-1-3(5)2-6/h3,6H,1-2H2/p+1.
What are the key properties of 2,3-dichloropropan-1-ol;hydron?
2,3-dichloropropan-1-ol;hydron has a molecular weight of 129.99 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloropropan-1-ol;hydron is sourced from PubChem (CID 174396616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).