About azane;2,2-dichloroethanol;nonakis(dichloromethane)
azane;2,2-dichloroethanol;nonakis(dichloromethane) (PubChem CID 173068778) has the molecular formula C11H52Cl20N10O
and a molecular weight of 1049.67 g/mol. Its IUPAC name is azane;2,2-dichloroethanol;nonakis(dichloromethane).
Molecular Properties
| Compound Name | azane;2,2-dichloroethanol;nonakis(dichloromethane) |
| PubChem CID | 173068778 |
| Molecular Formula | C11H52Cl20N10O |
| Molecular Weight | 1049.67 g/mol |
| Exact Mass | 1039.81 |
| IUPAC Name | azane;2,2-dichloroethanol;nonakis(dichloromethane) |
| SMILES | ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.N.N.N.N.N.N.N.N.N.N.OCC(Cl)Cl |
| InChI | InChI=1S/C2H4Cl2O.9CH2Cl2.10H3N/c3-2(4)1-5;9*2-1-3;;;;;;;;;;/h2,5H,1H2;9*1H2;10*1H3 |
| InChIKey | OOVOYRXEIAHNIU-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 370.23 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
4 violations
| Rule | Value |
| MW ≤ 500 | 1049.67 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;2,2-dichloroethanol;nonakis(dichloromethane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,2-dichloroethanol;nonakis(dichloromethane)?
The IUPAC name of azane;2,2-dichloroethanol;nonakis(dichloromethane) (CID 173068778) is azane;2,2-dichloroethanol;nonakis(dichloromethane).
What is the SMILES notation for azane;2,2-dichloroethanol;nonakis(dichloromethane)?
The canonical SMILES for azane;2,2-dichloroethanol;nonakis(dichloromethane) is ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.N.N.N.N.N.N.N.N.N.N.OCC(Cl)Cl.
What is the InChIKey of azane;2,2-dichloroethanol;nonakis(dichloromethane)?
The InChIKey is OOVOYRXEIAHNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Cl2O.9CH2Cl2.10H3N/c3-2(4)1-5;9*2-1-3;;;;;;;;;;/h2,5H,1H2;9*1H2;10*1H3.
What are the key properties of azane;2,2-dichloroethanol;nonakis(dichloromethane)?
azane;2,2-dichloroethanol;nonakis(dichloromethane) has a molecular weight of 1049.67 g/mol, XLogP of 15.20, 1 rotatable bonds, 11 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,2-dichloroethanol;nonakis(dichloromethane) is sourced from PubChem (CID 173068778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).