About dichloromethanol;titanium
dichloromethanol;titanium (PubChem CID 150712352) has the molecular formula CH2Cl2OTi
and a molecular weight of 148.80 g/mol. Its IUPAC name is dichloromethanol;titanium.
Molecular Properties
| Compound Name | dichloromethanol;titanium |
| PubChem CID | 150712352 |
| Molecular Formula | CH2Cl2OTi |
| Molecular Weight | 148.80 g/mol |
| Exact Mass | 147.90 |
| IUPAC Name | dichloromethanol;titanium |
| SMILES | OC(Cl)Cl.[Ti] |
| InChI | InChI=1S/CH2Cl2O.Ti/c2-1(3)4;/h1,4H; |
| InChIKey | DNFDFXISBRGLRG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.80 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethanol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethanol;titanium?
The IUPAC name of dichloromethanol;titanium (CID 150712352) is dichloromethanol;titanium.
What is the SMILES notation for dichloromethanol;titanium?
The canonical SMILES for dichloromethanol;titanium is OC(Cl)Cl.[Ti].
What is the InChIKey of dichloromethanol;titanium?
The InChIKey is DNFDFXISBRGLRG-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2Cl2O.Ti/c2-1(3)4;/h1,4H;.
What are the key properties of dichloromethanol;titanium?
dichloromethanol;titanium has a molecular weight of 148.80 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethanol;titanium is sourced from PubChem (CID 150712352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).