C4H7Cl3O2 — CID 118276207
2,3,4-trichlorobutane-1,1-diol (PubChem CID 118276207) has the molecular formula C4H7Cl3O2 and a molecular weight of 193.46 g/mol. Its IUPAC name is 2,3,4-trichlorobutane-1,1-diol.
| Compound Name | 2,3,4-trichlorobutane-1,1-diol |
|---|---|
| PubChem CID | 118276207 |
| Molecular Formula | C4H7Cl3O2 |
| Molecular Weight | 193.46 g/mol |
| Exact Mass | 191.95 |
| IUPAC Name | 2,3,4-trichlorobutane-1,1-diol |
| SMILES | OC(O)C(Cl)C(Cl)CCl |
| InChI | InChI=1S/C4H7Cl3O2/c5-1-2(6)3(7)4(8)9/h2-4,8-9H,1H2 |
| InChIKey | HRKAKAOBMSXVMD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.46 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|