About 3-(1,2-dichloroethyl)nonan-2-ol
3-(1,2-dichloroethyl)nonan-2-ol (PubChem CID 90809631) has the molecular formula C11H22Cl2O
and a molecular weight of 241.20 g/mol. Its IUPAC name is 3-(1,2-dichloroethyl)nonan-2-ol.
Molecular Properties
| Compound Name | 3-(1,2-dichloroethyl)nonan-2-ol |
| PubChem CID | 90809631 |
| Molecular Formula | C11H22Cl2O |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 3-(1,2-dichloroethyl)nonan-2-ol |
| SMILES | CCCCCCC(C(C)O)C(Cl)CCl |
| InChI | InChI=1S/C11H22Cl2O/c1-3-4-5-6-7-10(9(2)14)11(13)8-12/h9-11,14H,3-8H2,1-2H3 |
| InChIKey | VKNQSFPWRZNJFB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2-dichloroethyl)nonan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-dichloroethyl)nonan-2-ol?
The IUPAC name of 3-(1,2-dichloroethyl)nonan-2-ol (CID 90809631) is 3-(1,2-dichloroethyl)nonan-2-ol.
What is the SMILES notation for 3-(1,2-dichloroethyl)nonan-2-ol?
The canonical SMILES for 3-(1,2-dichloroethyl)nonan-2-ol is CCCCCCC(C(C)O)C(Cl)CCl.
What is the InChIKey of 3-(1,2-dichloroethyl)nonan-2-ol?
The InChIKey is VKNQSFPWRZNJFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22Cl2O/c1-3-4-5-6-7-10(9(2)14)11(13)8-12/h9-11,14H,3-8H2,1-2H3.
What are the key properties of 3-(1,2-dichloroethyl)nonan-2-ol?
3-(1,2-dichloroethyl)nonan-2-ol has a molecular weight of 241.20 g/mol, XLogP of 3.80, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-dichloroethyl)nonan-2-ol is sourced from PubChem (CID 90809631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).