C9H17Cl3O2 — CID 118275866
2,3,9-trichlorononane-1,1-diol (PubChem CID 118275866) has the molecular formula C9H17Cl3O2 and a molecular weight of 263.59 g/mol. Its IUPAC name is 2,3,9-trichlorononane-1,1-diol.
| Compound Name | 2,3,9-trichlorononane-1,1-diol |
|---|---|
| PubChem CID | 118275866 |
| Molecular Formula | C9H17Cl3O2 |
| Molecular Weight | 263.59 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 2,3,9-trichlorononane-1,1-diol |
| SMILES | OC(O)C(Cl)C(Cl)CCCCCCCl |
| InChI | InChI=1S/C9H17Cl3O2/c10-6-4-2-1-3-5-7(11)8(12)9(13)14/h7-9,13-14H,1-6H2 |
| InChIKey | XCKHWJASAHTUNX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|