C7H11Cl5 — CID 90233122
1,1,2,3,7-pentachloroheptane (PubChem CID 90233122) has the molecular formula C7H11Cl5 and a molecular weight of 272.43 g/mol. Its IUPAC name is 1,1,2,3,7-pentachloroheptane.
| Compound Name | 1,1,2,3,7-pentachloroheptane |
|---|---|
| PubChem CID | 90233122 |
| Molecular Formula | C7H11Cl5 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 269.93 |
| IUPAC Name | 1,1,2,3,7-pentachloroheptane |
| SMILES | ClCCCCC(Cl)C(Cl)C(Cl)Cl |
| InChI | InChI=1S/C7H11Cl5/c8-4-2-1-3-5(9)6(10)7(11)12/h5-7H,1-4H2 |
| InChIKey | FCVBKEBQRLFDID-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|