About 2,6-dichlorohexylphosphane
2,6-dichlorohexylphosphane (PubChem CID 20570467) has the molecular formula C6H13Cl2P
and a molecular weight of 187.05 g/mol. Its IUPAC name is 2,6-dichlorohexylphosphane.
Molecular Properties
| Compound Name | 2,6-dichlorohexylphosphane |
| PubChem CID | 20570467 |
| Molecular Formula | C6H13Cl2P |
| Molecular Weight | 187.05 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | 2,6-dichlorohexylphosphane |
| SMILES | PCC(Cl)CCCCCl |
| InChI | InChI=1S/C6H13Cl2P/c7-4-2-1-3-6(8)5-9/h6H,1-5,9H2 |
| InChIKey | LGWKQEAPHDKKRP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.05 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichlorohexylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichlorohexylphosphane?
The IUPAC name of 2,6-dichlorohexylphosphane (CID 20570467) is 2,6-dichlorohexylphosphane.
What is the SMILES notation for 2,6-dichlorohexylphosphane?
The canonical SMILES for 2,6-dichlorohexylphosphane is PCC(Cl)CCCCCl.
What is the InChIKey of 2,6-dichlorohexylphosphane?
The InChIKey is LGWKQEAPHDKKRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13Cl2P/c7-4-2-1-3-6(8)5-9/h6H,1-5,9H2.
What are the key properties of 2,6-dichlorohexylphosphane?
2,6-dichlorohexylphosphane has a molecular weight of 187.05 g/mol, XLogP of 2.88, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichlorohexylphosphane is sourced from PubChem (CID 20570467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).