About 2-(2,6-dichlorohexyl)phenol
2-(2,6-dichlorohexyl)phenol (PubChem CID 139629485) has the molecular formula C12H16Cl2O
and a molecular weight of 247.16 g/mol. Its IUPAC name is 2-(2,6-dichlorohexyl)phenol.
Molecular Properties
| Compound Name | 2-(2,6-dichlorohexyl)phenol |
| PubChem CID | 139629485 |
| Molecular Formula | C12H16Cl2O |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-(2,6-dichlorohexyl)phenol |
| SMILES | Oc1ccccc1CC(Cl)CCCCCl |
| InChI | InChI=1S/C12H16Cl2O/c13-8-4-3-6-11(14)9-10-5-1-2-7-12(10)15/h1-2,5,7,11,15H,3-4,6,8-9H2 |
| InChIKey | FTLHZGLNBOOCCG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dichlorohexyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dichlorohexyl)phenol?
The IUPAC name of 2-(2,6-dichlorohexyl)phenol (CID 139629485) is 2-(2,6-dichlorohexyl)phenol.
What is the SMILES notation for 2-(2,6-dichlorohexyl)phenol?
The canonical SMILES for 2-(2,6-dichlorohexyl)phenol is Oc1ccccc1CC(Cl)CCCCCl.
What is the InChIKey of 2-(2,6-dichlorohexyl)phenol?
The InChIKey is FTLHZGLNBOOCCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Cl2O/c13-8-4-3-6-11(14)9-10-5-1-2-7-12(10)15/h1-2,5,7,11,15H,3-4,6,8-9H2.
What are the key properties of 2-(2,6-dichlorohexyl)phenol?
2-(2,6-dichlorohexyl)phenol has a molecular weight of 247.16 g/mol, XLogP of 3.95, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorohexyl)phenol is sourced from PubChem (CID 139629485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).