C19H35Cl3O2 — CID 87906411
3,4,18-trichloro-2-methyloctadecanoic acid (PubChem CID 87906411) has the molecular formula C19H35Cl3O2 and a molecular weight of 401.85 g/mol. Its IUPAC name is 3,4,18-trichloro-2-methyloctadecanoic acid.
| Compound Name | 3,4,18-trichloro-2-methyloctadecanoic acid |
|---|---|
| PubChem CID | 87906411 |
| Molecular Formula | C19H35Cl3O2 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 3,4,18-trichloro-2-methyloctadecanoic acid |
| SMILES | CC(C(=O)O)C(Cl)C(Cl)CCCCCCCCCCCCCCCl |
| InChI | InChI=1S/C19H35Cl3O2/c1-16(19(23)24)18(22)17(21)14-12-10-8-6-4-2-3-5-7-9-11-13-15-20/h16-18H,2-15H2,1H3,(H,23,24) |
| InChIKey | KBQSDQLRDRJEGY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|