C18H32Cl4O2 — CID 118195492
2,3,4,18-tetrachlorooctadecanoic acid (PubChem CID 118195492) has the molecular formula C18H32Cl4O2 and a molecular weight of 422.26 g/mol. Its IUPAC name is 2,3,4,18-tetrachlorooctadecanoic acid.
| Compound Name | 2,3,4,18-tetrachlorooctadecanoic acid |
|---|---|
| PubChem CID | 118195492 |
| Molecular Formula | C18H32Cl4O2 |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2,3,4,18-tetrachlorooctadecanoic acid |
| SMILES | O=C(O)C(Cl)C(Cl)C(Cl)CCCCCCCCCCCCCCCl |
| InChI | InChI=1S/C18H32Cl4O2/c19-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(20)16(21)17(22)18(23)24/h15-17H,1-14H2,(H,23,24) |
| InChIKey | JJYFYZYJVWTMCF-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|