C11H22Cl3FO3Si — CID 175038963
trimethoxy-(2,3,8-trichloro-1-fluorooctyl)silane (PubChem CID 175038963) has the molecular formula C11H22Cl3FO3Si and a molecular weight of 355.74 g/mol. Its IUPAC name is trimethoxy-(2,3,8-trichloro-1-fluorooctyl)silane.
| Compound Name | trimethoxy-(2,3,8-trichloro-1-fluorooctyl)silane |
|---|---|
| PubChem CID | 175038963 |
| Molecular Formula | C11H22Cl3FO3Si |
| Molecular Weight | 355.74 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | trimethoxy-(2,3,8-trichloro-1-fluorooctyl)silane |
| SMILES | CO[Si](OC)(OC)C(F)C(Cl)C(Cl)CCCCCCl |
| InChI | InChI=1S/C11H22Cl3FO3Si/c1-16-19(17-2,18-3)11(15)10(14)9(13)7-5-4-6-8-12/h9-11H,4-8H2,1-3H3 |
| InChIKey | JISUVVRVQQOYIM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.74 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|