About 6-chlorohexane-1,2-diol
6-chlorohexane-1,2-diol (PubChem CID 87399395) has the molecular formula C6H13ClO2
and a molecular weight of 152.62 g/mol. Its IUPAC name is 6-chlorohexane-1,2-diol.
Molecular Properties
| Compound Name | 6-chlorohexane-1,2-diol |
| PubChem CID | 87399395 |
| Molecular Formula | C6H13ClO2 |
| Molecular Weight | 152.62 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 6-chlorohexane-1,2-diol |
| SMILES | OCC(O)CCCCCl |
| InChI | InChI=1S/C6H13ClO2/c7-4-2-1-3-6(9)5-8/h6,8-9H,1-5H2 |
| InChIKey | AFNCWTHDSLJPLI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.62 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chlorohexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorohexane-1,2-diol?
The IUPAC name of 6-chlorohexane-1,2-diol (CID 87399395) is 6-chlorohexane-1,2-diol.
What is the SMILES notation for 6-chlorohexane-1,2-diol?
The canonical SMILES for 6-chlorohexane-1,2-diol is OCC(O)CCCCCl.
What is the InChIKey of 6-chlorohexane-1,2-diol?
The InChIKey is AFNCWTHDSLJPLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13ClO2/c7-4-2-1-3-6(9)5-8/h6,8-9H,1-5H2.
What are the key properties of 6-chlorohexane-1,2-diol?
6-chlorohexane-1,2-diol has a molecular weight of 152.62 g/mol, XLogP of 0.75, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorohexane-1,2-diol is sourced from PubChem (CID 87399395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).