C4H6Cl4O — CID 88829524
1,2,3-trichloro-1-(chloromethoxy)propane (PubChem CID 88829524) has the molecular formula C4H6Cl4O and a molecular weight of 211.90 g/mol. Its IUPAC name is 1,2,3-trichloro-1-(chloromethoxy)propane.
| Compound Name | 1,2,3-trichloro-1-(chloromethoxy)propane |
|---|---|
| PubChem CID | 88829524 |
| Molecular Formula | C4H6Cl4O |
| Molecular Weight | 211.90 g/mol |
| Exact Mass | 209.92 |
| IUPAC Name | 1,2,3-trichloro-1-(chloromethoxy)propane |
| SMILES | ClCOC(Cl)C(Cl)CCl |
| InChI | InChI=1S/C4H6Cl4O/c5-1-3(7)4(8)9-2-6/h3-4H,1-2H2 |
| InChIKey | HIMWEGCQJZRUMB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.90 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|