C5H12ClNO — CID 59015298
1-(chloromethoxy)-N,N-dimethylethanamine (PubChem CID 59015298) has the molecular formula C5H12ClNO and a molecular weight of 137.61 g/mol. Its IUPAC name is 1-(chloromethoxy)-N,N-dimethylethanamine.
| Compound Name | 1-(chloromethoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 59015298 |
| Molecular Formula | C5H12ClNO |
| Molecular Weight | 137.61 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 1-(chloromethoxy)-N,N-dimethylethanamine |
| SMILES | CC(OCCl)N(C)C |
| InChI | InChI=1S/C5H12ClNO/c1-5(7(2)3)8-4-6/h5H,4H2,1-3H3 |
| InChIKey | BOSOVSNKAUTNBK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.61 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|