C9H23NO3Si — CID 140913993
1-[diethoxy(methyl)silyl]oxy-N,N-dimethylethanamine (PubChem CID 140913993) has the molecular formula C9H23NO3Si and a molecular weight of 221.37 g/mol. Its IUPAC name is 1-[diethoxy(methyl)silyl]oxy-N,N-dimethylethanamine.
| Compound Name | 1-[diethoxy(methyl)silyl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 140913993 |
| Molecular Formula | C9H23NO3Si |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-[diethoxy(methyl)silyl]oxy-N,N-dimethylethanamine |
| SMILES | CCO[Si](C)(OCC)OC(C)N(C)C |
| InChI | InChI=1S/C9H23NO3Si/c1-7-11-14(6,12-8-2)13-9(3)10(4)5/h9H,7-8H2,1-6H3 |
| InChIKey | XUIJHSQJIJEOEX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|