About diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane
diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane (PubChem CID 151989522) has the molecular formula C14H32O6Si
and a molecular weight of 324.49 g/mol. Its IUPAC name is diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane.
Molecular Properties
| Compound Name | diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane |
| PubChem CID | 151989522 |
| Molecular Formula | C14H32O6Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane |
| SMILES | CCOC(OCC)(OCC)C(C)O[Si](C)(OCC)OCC |
| InChI | InChI=1S/C14H32O6Si/c1-8-15-14(16-9-2,17-10-3)13(6)20-21(7,18-11-4)19-12-5/h13H,8-12H2,1-7H3 |
| InChIKey | UEJKDPFYLNKJKX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane?
The IUPAC name of diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane (CID 151989522) is diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane.
What is the SMILES notation for diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane?
The canonical SMILES for diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane is CCOC(OCC)(OCC)C(C)O[Si](C)(OCC)OCC.
What is the InChIKey of diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane?
The InChIKey is UEJKDPFYLNKJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32O6Si/c1-8-15-14(16-9-2,17-10-3)13(6)20-21(7,18-11-4)19-12-5/h13H,8-12H2,1-7H3.
What are the key properties of diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane?
diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane has a molecular weight of 324.49 g/mol, XLogP of 2.80, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-methyl-(1,1,1-triethoxypropan-2-yloxy)silane is sourced from PubChem (CID 151989522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).