C14H32O6Si — CID 175465706
(1,1-diethoxy-2-methylpropyl) triethyl silicate (PubChem CID 175465706) has the molecular formula C14H32O6Si and a molecular weight of 324.49 g/mol. Its IUPAC name is (1,1-diethoxy-2-methylpropyl) triethyl silicate.
| Compound Name | (1,1-diethoxy-2-methylpropyl) triethyl silicate |
|---|---|
| PubChem CID | 175465706 |
| Molecular Formula | C14H32O6Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (1,1-diethoxy-2-methylpropyl) triethyl silicate |
| SMILES | CCOC(OCC)(O[Si](OCC)(OCC)OCC)C(C)C |
| InChI | InChI=1S/C14H32O6Si/c1-8-15-14(13(6)7,16-9-2)20-21(17-10-3,18-11-4)19-12-5/h13H,8-12H2,1-7H3 |
| InChIKey | KAPIZKJXMVRCAQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|