About [diethoxy(triethoxysilyl)methyl] triethyl silicate
[diethoxy(triethoxysilyl)methyl] triethyl silicate (PubChem CID 58810725) has the molecular formula C17H40O9Si2
and a molecular weight of 444.67 g/mol. Its IUPAC name is [diethoxy(triethoxysilyl)methyl] triethyl silicate.
Molecular Properties
| Compound Name | [diethoxy(triethoxysilyl)methyl] triethyl silicate |
| PubChem CID | 58810725 |
| Molecular Formula | C17H40O9Si2 |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | [diethoxy(triethoxysilyl)methyl] triethyl silicate |
| SMILES | CCOC(OCC)(O[Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C17H40O9Si2/c1-9-18-17(19-10-2,27(20-11-3,21-12-4)22-13-5)26-28(23-14-6,24-15-7)25-16-8/h9-16H2,1-8H3 |
| InChIKey | QFIJPIXVEAJSFN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [diethoxy(triethoxysilyl)methyl] triethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diethoxy(triethoxysilyl)methyl] triethyl silicate?
The IUPAC name of [diethoxy(triethoxysilyl)methyl] triethyl silicate (CID 58810725) is [diethoxy(triethoxysilyl)methyl] triethyl silicate.
What is the SMILES notation for [diethoxy(triethoxysilyl)methyl] triethyl silicate?
The canonical SMILES for [diethoxy(triethoxysilyl)methyl] triethyl silicate is CCOC(OCC)(O[Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC.
What is the InChIKey of [diethoxy(triethoxysilyl)methyl] triethyl silicate?
The InChIKey is QFIJPIXVEAJSFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H40O9Si2/c1-9-18-17(19-10-2,27(20-11-3,21-12-4)22-13-5)26-28(23-14-6,24-15-7)25-16-8/h9-16H2,1-8H3.
What are the key properties of [diethoxy(triethoxysilyl)methyl] triethyl silicate?
[diethoxy(triethoxysilyl)methyl] triethyl silicate has a molecular weight of 444.67 g/mol, XLogP of 2.86, 19 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [diethoxy(triethoxysilyl)methyl] triethyl silicate is sourced from PubChem (CID 58810725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).