C12H28O5Si — CID 175450759
1,1-diethoxyethyl(triethoxy)silane (PubChem CID 175450759) has the molecular formula C12H28O5Si and a molecular weight of 280.44 g/mol. Its IUPAC name is 1,1-diethoxyethyl(triethoxy)silane.
| Compound Name | 1,1-diethoxyethyl(triethoxy)silane |
|---|---|
| PubChem CID | 175450759 |
| Molecular Formula | C12H28O5Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1,1-diethoxyethyl(triethoxy)silane |
| SMILES | CCOC(C)(OCC)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C12H28O5Si/c1-7-13-12(6,14-8-2)18(15-9-3,16-10-4)17-11-5/h7-11H2,1-6H3 |
| InChIKey | AQGSPXGZVIFEHP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|