C10H15F9O3Si — CID 23523578
triethoxy-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]silane (PubChem CID 23523578) has the molecular formula C10H15F9O3Si and a molecular weight of 382.30 g/mol. Its IUPAC name is triethoxy-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]silane.
| Compound Name | triethoxy-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]silane |
|---|---|
| PubChem CID | 23523578 |
| Molecular Formula | C10H15F9O3Si |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | triethoxy-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]silane |
| SMILES | CCO[Si](OCC)(OCC)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H15F9O3Si/c1-4-20-23(21-5-2,22-6-3)7(8(11,12)13,9(14,15)16)10(17,18)19/h4-6H2,1-3H3 |
| InChIKey | VFXNSEVACITCSM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|