C13H30O3Si — CID 18000011
triethoxy(2,3,3-trimethylbutan-2-yl)silane (PubChem CID 18000011) has the molecular formula C13H30O3Si and a molecular weight of 262.47 g/mol. Its IUPAC name is triethoxy(2,3,3-trimethylbutan-2-yl)silane.
| Compound Name | triethoxy(2,3,3-trimethylbutan-2-yl)silane |
|---|---|
| PubChem CID | 18000011 |
| Molecular Formula | C13H30O3Si |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | triethoxy(2,3,3-trimethylbutan-2-yl)silane |
| SMILES | CCO[Si](OCC)(OCC)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H30O3Si/c1-9-14-17(15-10-2,16-11-3)13(7,8)12(4,5)6/h9-11H2,1-8H3 |
| InChIKey | UIOOOWKDIMQZNK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|