About CID 87651559
CID 87651559 (PubChem CID 87651559) has the molecular formula C20H47O10Si4
and a molecular weight of 559.93 g/mol.
Molecular Properties
| Compound Name | CID 87651559 |
| PubChem CID | 87651559 |
| Molecular Formula | C20H47O10Si4 |
| Molecular Weight | 559.93 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | — |
| SMILES | CCO[Si](OCC)(OCC)C(CO[Si])([Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C20H47O10Si4/c1-10-22-32(23-11-2,24-12-3)20(19-21-31,33(25-13-4,26-14-5)27-15-6)34(28-16-7,29-17-8)30-18-9/h10-19H2,1-9H3 |
| InChIKey | DMTWMMKHTUDOGO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 559.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87651559 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87651559?
The IUPAC name of CID 87651559 (CID 87651559) is not available.
What is the SMILES notation for CID 87651559?
The canonical SMILES for CID 87651559 is CCO[Si](OCC)(OCC)C(CO[Si])([Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC.
What is the InChIKey of CID 87651559?
The InChIKey is DMTWMMKHTUDOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H47O10Si4/c1-10-22-32(23-11-2,24-12-3)20(19-21-31,33(25-13-4,26-14-5)27-15-6)34(28-16-7,29-17-8)30-18-9/h10-19H2,1-9H3.
What are the key properties of CID 87651559?
CID 87651559 has a molecular weight of 559.93 g/mol, XLogP of 3.05, 23 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87651559 is sourced from PubChem (CID 87651559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).