C14H33N3O3Si — CID 175426003
2-(2,2,3-trimethyl-3-triethoxysilylbutyl)guanidine (PubChem CID 175426003) has the molecular formula C14H33N3O3Si and a molecular weight of 319.52 g/mol. Its IUPAC name is 2-(2,2,3-trimethyl-3-triethoxysilylbutyl)guanidine.
| Compound Name | 2-(2,2,3-trimethyl-3-triethoxysilylbutyl)guanidine |
|---|---|
| PubChem CID | 175426003 |
| Molecular Formula | C14H33N3O3Si |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 2-(2,2,3-trimethyl-3-triethoxysilylbutyl)guanidine |
| SMILES | CCO[Si](OCC)(OCC)C(C)(C)C(C)(C)CN=C(N)N |
| InChI | InChI=1S/C14H33N3O3Si/c1-8-18-21(19-9-2,20-10-3)14(6,7)13(4,5)11-17-12(15)16/h8-11H2,1-7H3,(H4,15,16,17) |
| InChIKey | WVCVOGYROGFFBE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|