C20H30F16O7Si2 — CID 158351350
triethoxy(1,1,2,2,3,3,4,4,4-nonafluorobutyl)silane;triethoxy-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethyl]silane (PubChem CID 158351350) has the molecular formula C20H30F16O7Si2 and a molecular weight of 742.59 g/mol. Its IUPAC name is triethoxy(1,1,2,2,3,3,4,4,4-nonafluorobutyl)silane;triethoxy-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethyl]silane.
| Compound Name | triethoxy(1,1,2,2,3,3,4,4,4-nonafluorobutyl)silane;triethoxy-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethyl]silane |
|---|---|
| PubChem CID | 158351350 |
| Molecular Formula | C20H30F16O7Si2 |
| Molecular Weight | 742.59 g/mol |
| Exact Mass | 742.13 |
| IUPAC Name | triethoxy(1,1,2,2,3,3,4,4,4-nonafluorobutyl)silane;triethoxy-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethyl]silane |
| SMILES | CCO[Si](OCC)(OCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.CCO[Si](OCC)(OCC)C(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C10H15F9O3Si.C10H15F7O4Si/c1-4-20-23(21-5-2,22-6-3)10(18,19)8(13,14)7(11,12)9(15,16)17;1-4-18-22(19-5-2,20-6-3)10(16,17)9(14,15)21-8(13)7(11)12/h4-6H2,1-3H3;4-6H2,1-3H3 |
| InChIKey | GSIXFWSTYNSKLO-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.59 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|