C14H5ClF26OSi — CID 23523530
chloro-ethoxy-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)silane (PubChem CID 23523530) has the molecular formula C14H5ClF26OSi and a molecular weight of 746.68 g/mol. Its IUPAC name is chloro-ethoxy-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)silane.
| Compound Name | chloro-ethoxy-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)silane |
|---|---|
| PubChem CID | 23523530 |
| Molecular Formula | C14H5ClF26OSi |
| Molecular Weight | 746.68 g/mol |
| Exact Mass | 745.94 |
| IUPAC Name | chloro-ethoxy-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)silane |
| SMILES | CCO[Si](Cl)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H5ClF26OSi/c1-2-42-43(15,13(38,39)9(28,29)5(20,21)3(16,17)7(24,25)11(32,33)34)14(40,41)10(30,31)6(22,23)4(18,19)8(26,27)12(35,36)37/h2H2,1H3 |
| InChIKey | WNOILDBLTYAUQX-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.68 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|