C7F18O3Si — CID 87608961
1,1,2,2,3,3,4,4,4-nonafluorobutyl-tris(trifluoromethoxy)silane (PubChem CID 87608961) has the molecular formula C7F18O3Si and a molecular weight of 502.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutyl-tris(trifluoromethoxy)silane.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutyl-tris(trifluoromethoxy)silane |
|---|---|
| PubChem CID | 87608961 |
| Molecular Formula | C7F18O3Si |
| Molecular Weight | 502.12 g/mol |
| Exact Mass | 501.93 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutyl-tris(trifluoromethoxy)silane |
| SMILES | FC(F)(F)O[Si](OC(F)(F)F)(OC(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7F18O3Si/c8-1(9,3(12,13)14)2(10,11)4(15,16)29(26-5(17,18)19,27-6(20,21)22)28-7(23,24)25 |
| InChIKey | PUTBLPLUPLKFPV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.12 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|