C17H38F2O6Si2 — CID 87839555
(3,3-difluoro-4-triethoxysilylpentan-2-yl)-triethoxysilane (PubChem CID 87839555) has the molecular formula C17H38F2O6Si2 and a molecular weight of 432.65 g/mol. Its IUPAC name is (3,3-difluoro-4-triethoxysilylpentan-2-yl)-triethoxysilane.
| Compound Name | (3,3-difluoro-4-triethoxysilylpentan-2-yl)-triethoxysilane |
|---|---|
| PubChem CID | 87839555 |
| Molecular Formula | C17H38F2O6Si2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (3,3-difluoro-4-triethoxysilylpentan-2-yl)-triethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)C(C)C(F)(F)C(C)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C17H38F2O6Si2/c1-9-20-26(21-10-2,22-11-3)15(7)17(18,19)16(8)27(23-12-4,24-13-5)25-14-6/h15-16H,9-14H2,1-8H3 |
| InChIKey | IRHQDPXATGDTJD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|