C11H27NO3Si — CID 23051840
N,N-dimethyl-2-triethoxysilylpropan-1-amine (PubChem CID 23051840) has the molecular formula C11H27NO3Si and a molecular weight of 249.43 g/mol. Its IUPAC name is N,N-dimethyl-2-triethoxysilylpropan-1-amine.
| Compound Name | N,N-dimethyl-2-triethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 23051840 |
| Molecular Formula | C11H27NO3Si |
| Molecular Weight | 249.43 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N,N-dimethyl-2-triethoxysilylpropan-1-amine |
| SMILES | CCO[Si](OCC)(OCC)C(C)CN(C)C |
| InChI | InChI=1S/C11H27NO3Si/c1-7-13-16(14-8-2,15-9-3)11(4)10-12(5)6/h11H,7-10H2,1-6H3 |
| InChIKey | YRSCZVRKLQLPAY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|