C23H52N2O7Si2 — CID 175197450
1,1-bis(4-triethoxysilylpentyl)urea (PubChem CID 175197450) has the molecular formula C23H52N2O7Si2 and a molecular weight of 524.85 g/mol. Its IUPAC name is 1,1-bis(4-triethoxysilylpentyl)urea.
| Compound Name | 1,1-bis(4-triethoxysilylpentyl)urea |
|---|---|
| PubChem CID | 175197450 |
| Molecular Formula | C23H52N2O7Si2 |
| Molecular Weight | 524.85 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | 1,1-bis(4-triethoxysilylpentyl)urea |
| SMILES | CCO[Si](OCC)(OCC)C(C)CCCN(CCCC(C)[Si](OCC)(OCC)OCC)C(N)=O |
| InChI | InChI=1S/C23H52N2O7Si2/c1-9-27-33(28-10-2,29-11-3)21(7)17-15-19-25(23(24)26)20-16-18-22(8)34(30-12-4,31-13-5)32-14-6/h21-22H,9-20H2,1-8H3,(H2,24,26) |
| InChIKey | ZMFFQACIXLWVQW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.85 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|