C26H39BrN2O4Si — CID 18920593
2-methyl-N-[4-[N-(3-triethoxysilylbutyl)anilino]phenyl]prop-2-enamide;hydrobromide (PubChem CID 18920593) has the molecular formula C26H39BrN2O4Si and a molecular weight of 551.60 g/mol. Its IUPAC name is 2-methyl-N-[4-[N-(3-triethoxysilylbutyl)anilino]phenyl]prop-2-enamide;hydrobromide.
| Compound Name | 2-methyl-N-[4-[N-(3-triethoxysilylbutyl)anilino]phenyl]prop-2-enamide;hydrobromide |
|---|---|
| PubChem CID | 18920593 |
| Molecular Formula | C26H39BrN2O4Si |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 2-methyl-N-[4-[N-(3-triethoxysilylbutyl)anilino]phenyl]prop-2-enamide;hydrobromide |
| SMILES | Br.C=C(C)C(=O)Nc1ccc(N(CCC(C)[Si](OCC)(OCC)OCC)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H38N2O4Si.BrH/c1-7-30-33(31-8-2,32-9-3)22(6)19-20-28(24-13-11-10-12-14-24)25-17-15-23(16-18-25)27-26(29)21(4)5;/h10-18,22H,4,7-9,19-20H2,1-3,5-6H3,(H,27,29);1H |
| InChIKey | PUDVHYVQOLKCRC-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|