C15H36O6SSi2 — CID 91095961
3,3-bis(triethoxysilyl)propane-1-thiol (PubChem CID 91095961) has the molecular formula C15H36O6SSi2 and a molecular weight of 400.69 g/mol. Its IUPAC name is 3,3-bis(triethoxysilyl)propane-1-thiol.
| Compound Name | 3,3-bis(triethoxysilyl)propane-1-thiol |
|---|---|
| PubChem CID | 91095961 |
| Molecular Formula | C15H36O6SSi2 |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 3,3-bis(triethoxysilyl)propane-1-thiol |
| SMILES | CCO[Si](OCC)(OCC)C(CCS)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C15H36O6SSi2/c1-7-16-23(17-8-2,18-9-3)15(13-14-22)24(19-10-4,20-11-5)21-12-6/h15,22H,7-14H2,1-6H3 |
| InChIKey | CIDYEPOVCFOGMX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|