C20H42O11Si — CID 20571310
oxo-bis(1,1,2,2-tetraethoxyethoxy)silane (PubChem CID 20571310) has the molecular formula C20H42O11Si and a molecular weight of 486.63 g/mol. Its IUPAC name is oxo-bis(1,1,2,2-tetraethoxyethoxy)silane.
| Compound Name | oxo-bis(1,1,2,2-tetraethoxyethoxy)silane |
|---|---|
| PubChem CID | 20571310 |
| Molecular Formula | C20H42O11Si |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | oxo-bis(1,1,2,2-tetraethoxyethoxy)silane |
| SMILES | CCOC(OCC)C(OCC)(OCC)O[Si](=O)OC(OCC)(OCC)C(OCC)OCC |
| InChI | InChI=1S/C20H42O11Si/c1-9-22-17(23-10-2)19(26-13-5,27-14-6)30-32(21)31-20(28-15-7,29-16-8)18(24-11-3)25-12-4/h17-18H,9-16H2,1-8H3 |
| InChIKey | FVBIQIDOVPOJTB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|