C22H48O6Si2 — CID 173236882
[1,2,2-triethoxy-2-[4-(1,1,2-triethoxy-2-silylethyl)cyclohexyl]ethyl]silane (PubChem CID 173236882) has the molecular formula C22H48O6Si2 and a molecular weight of 464.79 g/mol. Its IUPAC name is [1,2,2-triethoxy-2-[4-(1,1,2-triethoxy-2-silylethyl)cyclohexyl]ethyl]silane.
| Compound Name | [1,2,2-triethoxy-2-[4-(1,1,2-triethoxy-2-silylethyl)cyclohexyl]ethyl]silane |
|---|---|
| PubChem CID | 173236882 |
| Molecular Formula | C22H48O6Si2 |
| Molecular Weight | 464.79 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | [1,2,2-triethoxy-2-[4-(1,1,2-triethoxy-2-silylethyl)cyclohexyl]ethyl]silane |
| SMILES | CCOC([SiH3])C(OCC)(OCC)C1CCC(C(OCC)(OCC)C([SiH3])OCC)CC1 |
| InChI | InChI=1S/C22H48O6Si2/c1-7-23-19(29)21(25-9-3,26-10-4)17-13-15-18(16-14-17)22(27-11-5,28-12-6)20(30)24-8-2/h17-20H,7-16H2,1-6,29-30H3 |
| InChIKey | OJLFEEIAOFXLME-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.79 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|