C9H23NO3Si — CID 152765619
1,1,3-triethoxy-3-silylpropan-1-amine (PubChem CID 152765619) has the molecular formula C9H23NO3Si and a molecular weight of 221.37 g/mol. Its IUPAC name is 1,1,3-triethoxy-3-silylpropan-1-amine.
| Compound Name | 1,1,3-triethoxy-3-silylpropan-1-amine |
|---|---|
| PubChem CID | 152765619 |
| Molecular Formula | C9H23NO3Si |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1,1,3-triethoxy-3-silylpropan-1-amine |
| SMILES | CCOC([SiH3])CC(N)(OCC)OCC |
| InChI | InChI=1S/C9H23NO3Si/c1-4-11-8(14)7-9(10,12-5-2)13-6-3/h8H,4-7,10H2,1-3,14H3 |
| InChIKey | SXGSXTZYTRKQDA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|