C7H20O2Si2 — CID 175503971
(1,2-diethoxy-1-silylpropyl)silane (PubChem CID 175503971) has the molecular formula C7H20O2Si2 and a molecular weight of 192.41 g/mol. Its IUPAC name is (1,2-diethoxy-1-silylpropyl)silane.
| Compound Name | (1,2-diethoxy-1-silylpropyl)silane |
|---|---|
| PubChem CID | 175503971 |
| Molecular Formula | C7H20O2Si2 |
| Molecular Weight | 192.41 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (1,2-diethoxy-1-silylpropyl)silane |
| SMILES | CCOC(C)C([SiH3])([SiH3])OCC |
| InChI | InChI=1S/C7H20O2Si2/c1-4-8-6(3)7(10,11)9-5-2/h6H,4-5H2,1-3,10-11H3 |
| InChIKey | KECHMSDBUCAWOT-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.41 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|