About 2-ethoxypropane;zinc
2-ethoxypropane;zinc (PubChem CID 174321747) has the molecular formula C5H12OZn
and a molecular weight of 153.54 g/mol. Its IUPAC name is 2-ethoxypropane;zinc.
Molecular Properties
| Compound Name | 2-ethoxypropane;zinc |
| PubChem CID | 174321747 |
| Molecular Formula | C5H12OZn |
| Molecular Weight | 153.54 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 2-ethoxypropane;zinc |
| SMILES | CCOC(C)C.[Zn] |
| InChI | InChI=1S/C5H12O.Zn/c1-4-6-5(2)3;/h5H,4H2,1-3H3; |
| InChIKey | LWAHLWGUXLAVNJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxypropane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxypropane;zinc?
The IUPAC name of 2-ethoxypropane;zinc (CID 174321747) is 2-ethoxypropane;zinc.
What is the SMILES notation for 2-ethoxypropane;zinc?
The canonical SMILES for 2-ethoxypropane;zinc is CCOC(C)C.[Zn].
What is the InChIKey of 2-ethoxypropane;zinc?
The InChIKey is LWAHLWGUXLAVNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.Zn/c1-4-6-5(2)3;/h5H,4H2,1-3H3;.
What are the key properties of 2-ethoxypropane;zinc?
2-ethoxypropane;zinc has a molecular weight of 153.54 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxypropane;zinc is sourced from PubChem (CID 174321747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).