C13H26O3 — CID 159586871
2-ethoxypropane;(3R)-3-ethylhexane-2,5-dione (PubChem CID 159586871) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-ethoxypropane;(3R)-3-ethylhexane-2,5-dione.
| Compound Name | 2-ethoxypropane;(3R)-3-ethylhexane-2,5-dione |
|---|---|
| PubChem CID | 159586871 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 2-ethoxypropane;(3R)-3-ethylhexane-2,5-dione |
| SMILES | CCOC(C)C.CC[C@H](CC(C)=O)C(C)=O |
| InChI | InChI=1S/C8H14O2.C5H12O/c1-4-8(7(3)10)5-6(2)9;1-4-6-5(2)3/h8H,4-5H2,1-3H3;5H,4H2,1-3H3/t8-;/m1./s1 |
| InChIKey | MJSNLCGXJHMQSM-DDWIOCJRSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |