C10H21NO3Si — CID 123656477
(1,1,2-triethoxy-3-isocyanopropyl)silane (PubChem CID 123656477) has the molecular formula C10H21NO3Si and a molecular weight of 231.37 g/mol. Its IUPAC name is (1,1,2-triethoxy-3-isocyanopropyl)silane.
| Compound Name | (1,1,2-triethoxy-3-isocyanopropyl)silane |
|---|---|
| PubChem CID | 123656477 |
| Molecular Formula | C10H21NO3Si |
| Molecular Weight | 231.37 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (1,1,2-triethoxy-3-isocyanopropyl)silane |
| SMILES | [C-]#[N+]CC(OCC)C([SiH3])(OCC)OCC |
| InChI | InChI=1S/C10H21NO3Si/c1-5-12-9(8-11-4)10(15,13-6-2)14-7-3/h9H,5-8H2,1-3,15H3 |
| InChIKey | YNKVKFLXEMYEHU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.37 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|