C11H24O4Si — CID 173157822
[1,1-diethoxy-2-(oxiran-2-ylmethoxy)butyl]silane (PubChem CID 173157822) has the molecular formula C11H24O4Si and a molecular weight of 248.39 g/mol. Its IUPAC name is [1,1-diethoxy-2-(oxiran-2-ylmethoxy)butyl]silane.
| Compound Name | [1,1-diethoxy-2-(oxiran-2-ylmethoxy)butyl]silane |
|---|---|
| PubChem CID | 173157822 |
| Molecular Formula | C11H24O4Si |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [1,1-diethoxy-2-(oxiran-2-ylmethoxy)butyl]silane |
| SMILES | CCOC([SiH3])(OCC)C(CC)OCC1CO1 |
| InChI | InChI=1S/C11H24O4Si/c1-4-10(13-8-9-7-12-9)11(16,14-5-2)15-6-3/h9-10H,4-8H2,1-3,16H3 |
| InChIKey | JPSWASBWKFTAID-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|