C9H21ClO3Si — CID 174751331
(3-chloro-1,1,2-triethoxypropyl)silane (PubChem CID 174751331) has the molecular formula C9H21ClO3Si and a molecular weight of 240.80 g/mol. Its IUPAC name is (3-chloro-1,1,2-triethoxypropyl)silane.
| Compound Name | (3-chloro-1,1,2-triethoxypropyl)silane |
|---|---|
| PubChem CID | 174751331 |
| Molecular Formula | C9H21ClO3Si |
| Molecular Weight | 240.80 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (3-chloro-1,1,2-triethoxypropyl)silane |
| SMILES | CCOC(CCl)C([SiH3])(OCC)OCC |
| InChI | InChI=1S/C9H21ClO3Si/c1-4-11-8(7-10)9(14,12-5-2)13-6-3/h8H,4-7H2,1-3,14H3 |
| InChIKey | DORHBWOOUMJCKV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.80 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|